C14H29N2O7P — CID 130314613
[5-[2-(dimethylamino)ethoxy]-2-[2-(dimethylamino)ethoxycarbonyl]-5-oxopentyl]phosphonic acid (PubChem CID 130314613) has the molecular formula C14H29N2O7P and a molecular weight of 368.37 g/mol. Its IUPAC name is [5-[2-(dimethylamino)ethoxy]-2-[2-(dimethylamino)ethoxycarbonyl]-5-oxopentyl]phosphonic acid.
| Compound Name | [5-[2-(dimethylamino)ethoxy]-2-[2-(dimethylamino)ethoxycarbonyl]-5-oxopentyl]phosphonic acid |
|---|---|
| PubChem CID | 130314613 |
| Molecular Formula | C14H29N2O7P |
| Molecular Weight | 368.37 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | [5-[2-(dimethylamino)ethoxy]-2-[2-(dimethylamino)ethoxycarbonyl]-5-oxopentyl]phosphonic acid |
| SMILES | CN(C)CCOC(=O)CCC(CP(=O)(O)O)C(=O)OCCN(C)C |
| InChI | InChI=1S/C14H29N2O7P/c1-15(2)7-9-22-13(17)6-5-12(11-24(19,20)21)14(18)23-10-8-16(3)4/h12H,5-11H2,1-4H3,(H2,19,20,21) |
| InChIKey | GUMGYVPJTMLCJV-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 116.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.37 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|