C21H36N2O4 — CID 130319946
N-[2,5-dimethyl-5-(2-methylpropoxy)hexan-2-yl]-3-(2,5-dioxopyrrol-1-yl)-3-methylbutanamide (PubChem CID 130319946) has the molecular formula C21H36N2O4 and a molecular weight of 380.53 g/mol. Its IUPAC name is N-[2,5-dimethyl-5-(2-methylpropoxy)hexan-2-yl]-3-(2,5-dioxopyrrol-1-yl)-3-methylbutanamide.
| Compound Name | N-[2,5-dimethyl-5-(2-methylpropoxy)hexan-2-yl]-3-(2,5-dioxopyrrol-1-yl)-3-methylbutanamide |
|---|---|
| PubChem CID | 130319946 |
| Molecular Formula | C21H36N2O4 |
| Molecular Weight | 380.53 g/mol |
| Exact Mass | 380.27 |
| IUPAC Name | N-[2,5-dimethyl-5-(2-methylpropoxy)hexan-2-yl]-3-(2,5-dioxopyrrol-1-yl)-3-methylbutanamide |
| SMILES | CC(C)COC(C)(C)CCC(C)(C)NC(=O)CC(C)(C)N1C(=O)C=CC1=O |
| InChI | InChI=1S/C21H36N2O4/c1-15(2)14-27-21(7,8)12-11-19(3,4)22-16(24)13-20(5,6)23-17(25)9-10-18(23)26/h9-10,15H,11-14H2,1-8H3,(H,22,24) |
| InChIKey | BTFDSIPBIYCMFP-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.53 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|