About 2-[3-(2,5-dioxopyrrol-1-yl)-3-methylbutoxy]-N'-methylacetohydrazide
2-[3-(2,5-dioxopyrrol-1-yl)-3-methylbutoxy]-N'-methylacetohydrazide (PubChem CID 174277873) has the molecular formula C12H19N3O4
and a molecular weight of 269.30 g/mol. Its IUPAC name is 2-[3-(2,5-dioxopyrrol-1-yl)-3-methylbutoxy]-N'-methylacetohydrazide.
Molecular Properties
| Compound Name | 2-[3-(2,5-dioxopyrrol-1-yl)-3-methylbutoxy]-N'-methylacetohydrazide |
| PubChem CID | 174277873 |
| Molecular Formula | C12H19N3O4 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | 2-[3-(2,5-dioxopyrrol-1-yl)-3-methylbutoxy]-N'-methylacetohydrazide |
| SMILES | CNNC(=O)COCCC(C)(C)N1C(=O)C=CC1=O |
| InChI | InChI=1S/C12H19N3O4/c1-12(2,15-10(17)4-5-11(15)18)6-7-19-8-9(16)14-13-3/h4-5,13H,6-8H2,1-3H3,(H,14,16) |
| InChIKey | UATIFQUCUVYYSL-UHFFFAOYSA-N |
| XLogP | -0.65 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 2-[3-(2,5-dioxopyrrol-1-yl)-3-methylbutoxy]-N'-methylacetohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-(2,5-dioxopyrrol-1-yl)-3-methylbutoxy]-N'-methylacetohydrazide?
The IUPAC name of 2-[3-(2,5-dioxopyrrol-1-yl)-3-methylbutoxy]-N'-methylacetohydrazide (CID 174277873) is 2-[3-(2,5-dioxopyrrol-1-yl)-3-methylbutoxy]-N'-methylacetohydrazide.
What is the SMILES notation for 2-[3-(2,5-dioxopyrrol-1-yl)-3-methylbutoxy]-N'-methylacetohydrazide?
The canonical SMILES for 2-[3-(2,5-dioxopyrrol-1-yl)-3-methylbutoxy]-N'-methylacetohydrazide is CNNC(=O)COCCC(C)(C)N1C(=O)C=CC1=O.
What is the InChIKey of 2-[3-(2,5-dioxopyrrol-1-yl)-3-methylbutoxy]-N'-methylacetohydrazide?
The InChIKey is UATIFQUCUVYYSL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19N3O4/c1-12(2,15-10(17)4-5-11(15)18)6-7-19-8-9(16)14-13-3/h4-5,13H,6-8H2,1-3H3,(H,14,16).
What are the key properties of 2-[3-(2,5-dioxopyrrol-1-yl)-3-methylbutoxy]-N'-methylacetohydrazide?
2-[3-(2,5-dioxopyrrol-1-yl)-3-methylbutoxy]-N'-methylacetohydrazide has a molecular weight of 269.30 g/mol, XLogP of -0.65, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-(2,5-dioxopyrrol-1-yl)-3-methylbutoxy]-N'-methylacetohydrazide is sourced from PubChem (CID 174277873), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).