C12H19N3O4 — CID 174277873
2-[3-(2,5-dioxopyrrol-1-yl)-3-methylbutoxy]-N'-methylacetohydrazide (PubChem CID 174277873) has the molecular formula C12H19N3O4 and a molecular weight of 269.30 g/mol. Its IUPAC name is 2-[3-(2,5-dioxopyrrol-1-yl)-3-methylbutoxy]-N'-methylacetohydrazide.
| Compound Name | 2-[3-(2,5-dioxopyrrol-1-yl)-3-methylbutoxy]-N'-methylacetohydrazide |
|---|---|
| PubChem CID | 174277873 |
| Molecular Formula | C12H19N3O4 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | 2-[3-(2,5-dioxopyrrol-1-yl)-3-methylbutoxy]-N'-methylacetohydrazide |
| SMILES | CNNC(=O)COCCC(C)(C)N1C(=O)C=CC1=O |
| InChI | InChI=1S/C12H19N3O4/c1-12(2,15-10(17)4-5-11(15)18)6-7-19-8-9(16)14-13-3/h4-5,13H,6-8H2,1-3H3,(H,14,16) |
| InChIKey | UATIFQUCUVYYSL-UHFFFAOYSA-N |
| XLogP | -0.65 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|