C17H29NO4 — CID 155076992
1-[3-methyl-3-[2-methyl-2-(2-methylpropoxy)propoxy]butyl]pyrrole-2,5-dione (PubChem CID 155076992) has the molecular formula C17H29NO4 and a molecular weight of 311.42 g/mol. Its IUPAC name is 1-[3-methyl-3-[2-methyl-2-(2-methylpropoxy)propoxy]butyl]pyrrole-2,5-dione.
| Compound Name | 1-[3-methyl-3-[2-methyl-2-(2-methylpropoxy)propoxy]butyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 155076992 |
| Molecular Formula | C17H29NO4 |
| Molecular Weight | 311.42 g/mol |
| Exact Mass | 311.21 |
| IUPAC Name | 1-[3-methyl-3-[2-methyl-2-(2-methylpropoxy)propoxy]butyl]pyrrole-2,5-dione |
| SMILES | CC(C)COC(C)(C)COC(C)(C)CCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C17H29NO4/c1-13(2)11-21-17(5,6)12-22-16(3,4)9-10-18-14(19)7-8-15(18)20/h7-8,13H,9-12H2,1-6H3 |
| InChIKey | OBEQZKNZLDLCTG-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.42 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|