C15H24NO3P — CID 177144743
2,2-dimethyl-4-[2-methyl-4-(2-oxo-5-phosphanylidenepyrrol-1-yl)butan-2-yl]oxybutanal (PubChem CID 177144743) has the molecular formula C15H24NO3P and a molecular weight of 297.33 g/mol. Its IUPAC name is 2,2-dimethyl-4-[2-methyl-4-(2-oxo-5-phosphanylidenepyrrol-1-yl)butan-2-yl]oxybutanal.
| Compound Name | 2,2-dimethyl-4-[2-methyl-4-(2-oxo-5-phosphanylidenepyrrol-1-yl)butan-2-yl]oxybutanal |
|---|---|
| PubChem CID | 177144743 |
| Molecular Formula | C15H24NO3P |
| Molecular Weight | 297.33 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | 2,2-dimethyl-4-[2-methyl-4-(2-oxo-5-phosphanylidenepyrrol-1-yl)butan-2-yl]oxybutanal |
| SMILES | [H]/P=C1\C=CC(=O)N1CCC(C)(C)OCCC(C)(C)C=O |
| InChI | InChI=1S/C15H24NO3P/c1-14(2,11-17)8-10-19-15(3,4)7-9-16-12(18)5-6-13(16)20/h5-6,11,20H,7-10H2,1-4H3 |
| InChIKey | JOJJDWBUSIGMQJ-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.33 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|