C12H17N3O2S — CID 130328037
(5E)-1,3-dimethyl-5-[(E)-3-morpholin-4-ylprop-2-enylidene]-2-sulfanylideneimidazolidin-4-one (PubChem CID 130328037) has the molecular formula C12H17N3O2S and a molecular weight of 267.35 g/mol. Its IUPAC name is (5E)-1,3-dimethyl-5-[(E)-3-morpholin-4-ylprop-2-enylidene]-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (5E)-1,3-dimethyl-5-[(E)-3-morpholin-4-ylprop-2-enylidene]-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 130328037 |
| Molecular Formula | C12H17N3O2S |
| Molecular Weight | 267.35 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | (5E)-1,3-dimethyl-5-[(E)-3-morpholin-4-ylprop-2-enylidene]-2-sulfanylideneimidazolidin-4-one |
| SMILES | CN1C(=O)/C(=C\C=C\N2CCOCC2)N(C)C1=S |
| InChI | InChI=1S/C12H17N3O2S/c1-13-10(11(16)14(2)12(13)18)4-3-5-15-6-8-17-9-7-15/h3-5H,6-9H2,1-2H3/b5-3+,10-4+ |
| InChIKey | UDAFBTHPXVURGX-OXWOXFIQSA-N |
| XLogP | 0.40 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.35 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|