C16H18Cl2N2O4 — CID 5341257
2,5-dichloro-3-morpholin-4-yl-6-[(E)-2-morpholin-4-ylethenyl]cyclohexa-2,5-diene-1,4-dione (PubChem CID 5341257) has the molecular formula C16H18Cl2N2O4 and a molecular weight of 373.24 g/mol. Its IUPAC name is 2,5-dichloro-3-morpholin-4-yl-6-[(E)-2-morpholin-4-ylethenyl]cyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2,5-dichloro-3-morpholin-4-yl-6-[(E)-2-morpholin-4-ylethenyl]cyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 5341257 |
| Molecular Formula | C16H18Cl2N2O4 |
| Molecular Weight | 373.24 g/mol |
| Exact Mass | 372.06 |
| IUPAC Name | 2,5-dichloro-3-morpholin-4-yl-6-[(E)-2-morpholin-4-ylethenyl]cyclohexa-2,5-diene-1,4-dione |
| SMILES | O=C1C(Cl)=C(N2CCOCC2)C(=O)C(Cl)=C1/C=C/N1CCOCC1 |
| InChI | InChI=1S/C16H18Cl2N2O4/c17-12-11(1-2-19-3-7-23-8-4-19)15(21)13(18)14(16(12)22)20-5-9-24-10-6-20/h1-2H,3-10H2/b2-1+ |
| InChIKey | CCRJVXCIIXGOJO-OWOJBTEDSA-N |
| XLogP | 1.26 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.24 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|