C23H24BrNO3S — CID 130330872
(2E,4Z)-1-[1-(benzenesulfonyl)piperidin-4-yl]-5-bromo-4-phenylhexa-2,4-dien-1-one (PubChem CID 130330872) has the molecular formula C23H24BrNO3S and a molecular weight of 474.42 g/mol. Its IUPAC name is (2E,4Z)-1-[1-(benzenesulfonyl)piperidin-4-yl]-5-bromo-4-phenylhexa-2,4-dien-1-one.
| Compound Name | (2E,4Z)-1-[1-(benzenesulfonyl)piperidin-4-yl]-5-bromo-4-phenylhexa-2,4-dien-1-one |
|---|---|
| PubChem CID | 130330872 |
| Molecular Formula | C23H24BrNO3S |
| Molecular Weight | 474.42 g/mol |
| Exact Mass | 473.07 |
| IUPAC Name | (2E,4Z)-1-[1-(benzenesulfonyl)piperidin-4-yl]-5-bromo-4-phenylhexa-2,4-dien-1-one |
| SMILES | C/C(Br)=C(\C=C\C(=O)C1CCN(S(=O)(=O)c2ccccc2)CC1)c1ccccc1 |
| InChI | InChI=1S/C23H24BrNO3S/c1-18(24)22(19-8-4-2-5-9-19)12-13-23(26)20-14-16-25(17-15-20)29(27,28)21-10-6-3-7-11-21/h2-13,20H,14-17H2,1H3/b13-12+,22-18- |
| InChIKey | NPTOXINUILOVAB-QONRLOOASA-N |
| XLogP | 5.04 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.42 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|