C15H30N2O — CID 130335978
(2R,3S)-2-[(4-propan-2-ylcyclohexyl)oxymethyl]piperidin-3-amine (PubChem CID 130335978) has the molecular formula C15H30N2O and a molecular weight of 254.42 g/mol. Its IUPAC name is (2R,3S)-2-[(4-propan-2-ylcyclohexyl)oxymethyl]piperidin-3-amine.
| Compound Name | (2R,3S)-2-[(4-propan-2-ylcyclohexyl)oxymethyl]piperidin-3-amine |
|---|---|
| PubChem CID | 130335978 |
| Molecular Formula | C15H30N2O |
| Molecular Weight | 254.42 g/mol |
| Exact Mass | 254.24 |
| IUPAC Name | (2R,3S)-2-[(4-propan-2-ylcyclohexyl)oxymethyl]piperidin-3-amine |
| SMILES | CC(C)C1CCC(OC[C@@H]2NCCC[C@@H]2N)CC1 |
| InChI | InChI=1S/C15H30N2O/c1-11(2)12-5-7-13(8-6-12)18-10-15-14(16)4-3-9-17-15/h11-15,17H,3-10,16H2,1-2H3/t12?,13?,14-,15-/m0/s1 |
| InChIKey | GKECYYQHVDJYIU-WUCCLRPBSA-N |
| XLogP | 2.30 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.42 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |