C19H32N2O — CID 154681369
ethane;2-[(4-phenylcyclohexyl)oxymethyl]pyrrolidin-3-amine (PubChem CID 154681369) has the molecular formula C19H32N2O and a molecular weight of 304.48 g/mol. Its IUPAC name is ethane;2-[(4-phenylcyclohexyl)oxymethyl]pyrrolidin-3-amine.
| Compound Name | ethane;2-[(4-phenylcyclohexyl)oxymethyl]pyrrolidin-3-amine |
|---|---|
| PubChem CID | 154681369 |
| Molecular Formula | C19H32N2O |
| Molecular Weight | 304.48 g/mol |
| Exact Mass | 304.25 |
| IUPAC Name | ethane;2-[(4-phenylcyclohexyl)oxymethyl]pyrrolidin-3-amine |
| SMILES | CC.NC1CCNC1COC1CCC(c2ccccc2)CC1 |
| InChI | InChI=1S/C17H26N2O.C2H6/c18-16-10-11-19-17(16)12-20-15-8-6-14(7-9-15)13-4-2-1-3-5-13;1-2/h1-5,14-17,19H,6-12,18H2;1-2H3 |
| InChIKey | ISKPOLGHHHLOES-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.48 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |