C9H9N — CID 130336522
(4R)-4-methyl-3,4-dihydrocyclopenta[c]pyridine (PubChem CID 130336522) has the molecular formula C9H9N and a molecular weight of 131.18 g/mol. Its IUPAC name is (4R)-4-methyl-3,4-dihydrocyclopenta[c]pyridine.
| Compound Name | (4R)-4-methyl-3,4-dihydrocyclopenta[c]pyridine |
|---|---|
| PubChem CID | 130336522 |
| Molecular Formula | C9H9N |
| Molecular Weight | 131.18 g/mol |
| Exact Mass | 131.07 |
| IUPAC Name | (4R)-4-methyl-3,4-dihydrocyclopenta[c]pyridine |
| SMILES | C[C@H]1CN=CC2=C1C=C=C2 |
| InChI | InChI=1S/C9H9N/c1-7-5-10-6-8-3-2-4-9(7)8/h3-4,6-7H,5H2,1H3/t7-/m0/s1 |
| InChIKey | CVDWOTHUKLUWAM-ZETCQYMHSA-N |
| XLogP | 1.73 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 131.18 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |