C47H36N4 — CID 130351406
(11Z)-15-[4-(4-cyclohexa-1,5-dien-1-yl-6-phenyl-1,3,5-triazin-2-yl)phenyl]-9-naphthalen-1-yl-9-azatricyclo[11.4.0.03,8]heptadeca-1(13),3,5,7,11,14,16-heptaene (PubChem CID 130351406) has the molecular formula C47H36N4 and a molecular weight of 656.83 g/mol. Its IUPAC name is (11Z)-15-[4-(4-cyclohexa-1,5-dien-1-yl-6-phenyl-1,3,5-triazin-2-yl)phenyl]-9-naphthalen-1-yl-9-azatricyclo[11.4.0.03,8]heptadeca-1(13),3,5,7,11,14,16-heptaene.
| Compound Name | (11Z)-15-[4-(4-cyclohexa-1,5-dien-1-yl-6-phenyl-1,3,5-triazin-2-yl)phenyl]-9-naphthalen-1-yl-9-azatricyclo[11.4.0.03,8]heptadeca-1(13),3,5,7,11,14,16-heptaene |
|---|---|
| PubChem CID | 130351406 |
| Molecular Formula | C47H36N4 |
| Molecular Weight | 656.83 g/mol |
| Exact Mass | 656.29 |
| IUPAC Name | (11Z)-15-[4-(4-cyclohexa-1,5-dien-1-yl-6-phenyl-1,3,5-triazin-2-yl)phenyl]-9-naphthalen-1-yl-9-azatricyclo[11.4.0.03,8]heptadeca-1(13),3,5,7,11,14,16-heptaene |
| SMILES | C1=CC(c2nc(-c3ccccc3)nc(-c3ccc(-c4ccc5c(c4)/C=C\CN(c4cccc6ccccc46)c4ccccc4C5)cc3)n2)=CCC1 |
| InChI | InChI=1S/C47H36N4/c1-3-14-35(15-4-1)45-48-46(36-16-5-2-6-17-36)50-47(49-45)37-26-24-33(25-27-37)39-28-29-40-32-41-18-8-10-22-43(41)51(30-12-20-38(40)31-39)44-23-11-19-34-13-7-9-21-42(34)44/h1,3-5,7-29,31H,2,6,30,32H2/b20-12- |
| InChIKey | BGVOBFSTEKTAKZ-NDENLUEZSA-N |
| XLogP | 11.51 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.83 |
| LogP ≤ 5 | 11.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |