C10H13N — CID 130351512
3-ethenyl-1,4-dimethyl-2,5-dimethylidenepyrrole (PubChem CID 130351512) has the molecular formula C10H13N and a molecular weight of 147.22 g/mol. Its IUPAC name is 3-ethenyl-1,4-dimethyl-2,5-dimethylidenepyrrole.
| Compound Name | 3-ethenyl-1,4-dimethyl-2,5-dimethylidenepyrrole |
|---|---|
| PubChem CID | 130351512 |
| Molecular Formula | C10H13N |
| Molecular Weight | 147.22 g/mol |
| Exact Mass | 147.10 |
| IUPAC Name | 3-ethenyl-1,4-dimethyl-2,5-dimethylidenepyrrole |
| SMILES | C=Cc1c(C)c(=C)n(C)c1=C |
| InChI | InChI=1S/C10H13N/c1-6-10-7(2)8(3)11(5)9(10)4/h6H,1,3-4H2,2,5H3 |
| InChIKey | QTMNLHBVUPPMMH-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.22 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |