C8H6N4O2 — CID 130352001
5,11-dimethyl-4,10-dioxa-2,6,8,12-tetrazatricyclo[7.3.0.03,7]dodeca-1(9),2,5,7,11-pentaene (PubChem CID 130352001) has the molecular formula C8H6N4O2 and a molecular weight of 190.16 g/mol. Its IUPAC name is 5,11-dimethyl-4,10-dioxa-2,6,8,12-tetrazatricyclo[7.3.0.03,7]dodeca-1(9),2,5,7,11-pentaene.
| Compound Name | 5,11-dimethyl-4,10-dioxa-2,6,8,12-tetrazatricyclo[7.3.0.03,7]dodeca-1(9),2,5,7,11-pentaene |
|---|---|
| PubChem CID | 130352001 |
| Molecular Formula | C8H6N4O2 |
| Molecular Weight | 190.16 g/mol |
| Exact Mass | 190.05 |
| IUPAC Name | 5,11-dimethyl-4,10-dioxa-2,6,8,12-tetrazatricyclo[7.3.0.03,7]dodeca-1(9),2,5,7,11-pentaene |
| SMILES | Cc1nc2nc3oc(C)nc3nc2o1 |
| InChI | InChI=1S/C8H6N4O2/c1-3-9-5-7(13-3)12-6-8(11-5)14-4(2)10-6/h1-2H3 |
| InChIKey | ASROWSDBEYHHNH-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 77.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.16 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |