About 2-methyl-[1,3]oxazolo[5,4-d]pyrimidine-5-carbonitrile
2-methyl-[1,3]oxazolo[5,4-d]pyrimidine-5-carbonitrile (PubChem CID 130048004) has the molecular formula C7H4N4O
and a molecular weight of 160.14 g/mol. Its IUPAC name is 2-methyl-[1,3]oxazolo[5,4-d]pyrimidine-5-carbonitrile.
Analyze 2-methyl-[1,3]oxazolo[5,4-d]pyrimidine-5-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-[1,3]oxazolo[5,4-d]pyrimidine-5-carbonitrile?
The IUPAC name of 2-methyl-[1,3]oxazolo[5,4-d]pyrimidine-5-carbonitrile (CID 130048004) is 2-methyl-[1,3]oxazolo[5,4-d]pyrimidine-5-carbonitrile.
What is the SMILES notation for 2-methyl-[1,3]oxazolo[5,4-d]pyrimidine-5-carbonitrile?
The canonical SMILES for 2-methyl-[1,3]oxazolo[5,4-d]pyrimidine-5-carbonitrile is Cc1nc2cnc(C#N)nc2o1.
What is the InChIKey of 2-methyl-[1,3]oxazolo[5,4-d]pyrimidine-5-carbonitrile?
The InChIKey is MENRODCPOYTGLO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4N4O/c1-4-10-5-3-9-6(2-8)11-7(5)12-4/h3H,1H3.
What are the key properties of 2-methyl-[1,3]oxazolo[5,4-d]pyrimidine-5-carbonitrile?
2-methyl-[1,3]oxazolo[5,4-d]pyrimidine-5-carbonitrile has a molecular weight of 160.14 g/mol, XLogP of 0.80, 0 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-[1,3]oxazolo[5,4-d]pyrimidine-5-carbonitrile is sourced from PubChem (CID 130048004), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).