C18H25NO2 — CID 130354886
8-butoxy-3,3,7-trimethyl-3a,9b-dihydro-1H-furo[3,4-c]isoquinoline (PubChem CID 130354886) has the molecular formula C18H25NO2 and a molecular weight of 287.40 g/mol. Its IUPAC name is 8-butoxy-3,3,7-trimethyl-3a,9b-dihydro-1H-furo[3,4-c]isoquinoline.
| Compound Name | 8-butoxy-3,3,7-trimethyl-3a,9b-dihydro-1H-furo[3,4-c]isoquinoline |
|---|---|
| PubChem CID | 130354886 |
| Molecular Formula | C18H25NO2 |
| Molecular Weight | 287.40 g/mol |
| Exact Mass | 287.19 |
| IUPAC Name | 8-butoxy-3,3,7-trimethyl-3a,9b-dihydro-1H-furo[3,4-c]isoquinoline |
| SMILES | CCCCOc1cc2c(cc1C)C=NC1C2COC1(C)C |
| InChI | InChI=1S/C18H25NO2/c1-5-6-7-20-16-9-14-13(8-12(16)2)10-19-17-15(14)11-21-18(17,3)4/h8-10,15,17H,5-7,11H2,1-4H3 |
| InChIKey | ACFXYMMATBSFPD-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.40 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|