C27H41N — CID 130356405
2,3,5,5-tetramethyl-3-phenyl-2-(1-phenylethyl)nonan-1-amine (PubChem CID 130356405) has the molecular formula C27H41N and a molecular weight of 379.63 g/mol. Its IUPAC name is 2,3,5,5-tetramethyl-3-phenyl-2-(1-phenylethyl)nonan-1-amine.
| Compound Name | 2,3,5,5-tetramethyl-3-phenyl-2-(1-phenylethyl)nonan-1-amine |
|---|---|
| PubChem CID | 130356405 |
| Molecular Formula | C27H41N |
| Molecular Weight | 379.63 g/mol |
| Exact Mass | 379.32 |
| IUPAC Name | 2,3,5,5-tetramethyl-3-phenyl-2-(1-phenylethyl)nonan-1-amine |
| SMILES | CCCCC(C)(C)CC(C)(c1ccccc1)C(C)(CN)C(C)c1ccccc1 |
| InChI | InChI=1S/C27H41N/c1-7-8-19-25(3,4)20-26(5,24-17-13-10-14-18-24)27(6,21-28)22(2)23-15-11-9-12-16-23/h9-18,22H,7-8,19-21,28H2,1-6H3 |
| InChIKey | ADCOMTSFYOYZDG-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.63 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |