About CID 67364788
CID 67364788 (PubChem CID 67364788) has the molecular formula C17H27OSn
and a molecular weight of 366.11 g/mol.
Molecular Properties
| Compound Name | CID 67364788 |
| PubChem CID | 67364788 |
| Molecular Formula | C17H27OSn |
| Molecular Weight | 366.11 g/mol |
| Exact Mass | 367.11 |
| IUPAC Name | — |
| SMILES | CCCCC(CCCC)(O[Sn])C(C)c1ccccc1 |
| InChI | InChI=1S/C17H27O.Sn/c1-4-6-13-17(18,14-7-5-2)15(3)16-11-9-8-10-12-16;/h8-12,15H,4-7,13-14H2,1-3H3;/q-1;+1 |
| InChIKey | RKSZJFUPBITAPQ-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 366.11 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze CID 67364788 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 67364788?
The IUPAC name of CID 67364788 (CID 67364788) is not available.
What is the SMILES notation for CID 67364788?
The canonical SMILES for CID 67364788 is CCCCC(CCCC)(O[Sn])C(C)c1ccccc1.
What is the InChIKey of CID 67364788?
The InChIKey is RKSZJFUPBITAPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H27O.Sn/c1-4-6-13-17(18,14-7-5-2)15(3)16-11-9-8-10-12-16;/h8-12,15H,4-7,13-14H2,1-3H3;/q-1;+1.
What are the key properties of CID 67364788?
CID 67364788 has a molecular weight of 366.11 g/mol, XLogP of 5.01, 9 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 67364788 is sourced from PubChem (CID 67364788), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).