C17H26 — CID 15652057
[(2R,3R)-3-ethenyl-3-ethylheptan-2-yl]benzene (PubChem CID 15652057) has the molecular formula C17H26 and a molecular weight of 230.39 g/mol. Its IUPAC name is [(2R,3R)-3-ethenyl-3-ethylheptan-2-yl]benzene.
| Compound Name | [(2R,3R)-3-ethenyl-3-ethylheptan-2-yl]benzene |
|---|---|
| PubChem CID | 15652057 |
| Molecular Formula | C17H26 |
| Molecular Weight | 230.39 g/mol |
| Exact Mass | 230.20 |
| IUPAC Name | [(2R,3R)-3-ethenyl-3-ethylheptan-2-yl]benzene |
| SMILES | C=C[C@@](CC)(CCCC)[C@@H](C)c1ccccc1 |
| InChI | InChI=1S/C17H26/c1-5-8-14-17(6-2,7-3)15(4)16-12-10-9-11-13-16/h6,9-13,15H,2,5,7-8,14H2,1,3-4H3/t15-,17+/m0/s1 |
| InChIKey | RCPKOQRXUFBUSV-DOTOQJQBSA-N |
| XLogP | 5.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.39 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|