C23H42N4 — CID 130361917
N,N'-diamino-4-(10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)butanimidamide (PubChem CID 130361917) has the molecular formula C23H42N4 and a molecular weight of 374.62 g/mol. Its IUPAC name is N,N'-diamino-4-(10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)butanimidamide.
| Compound Name | N,N'-diamino-4-(10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)butanimidamide |
|---|---|
| PubChem CID | 130361917 |
| Molecular Formula | C23H42N4 |
| Molecular Weight | 374.62 g/mol |
| Exact Mass | 374.34 |
| IUPAC Name | N,N'-diamino-4-(10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)butanimidamide |
| SMILES | CC12CCCCC1CCC1C2CCC2(C)C(CCC/C(=N/N)NN)CCC12 |
| InChI | InChI=1S/C23H42N4/c1-22-14-4-3-6-16(22)9-11-18-19-12-10-17(7-5-8-21(26-24)27-25)23(19,2)15-13-20(18)22/h16-20H,3-15,24-25H2,1-2H3,(H,26,27) |
| InChIKey | GZVXEJSMGZLBDI-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 76.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.62 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|