C16H18F2O8 — CID 130374803
(9-hydroxy-10-oxospiro[3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecane-4,5'-bicyclo[2.2.1]heptane]-2'-yl) 2,2-difluoropropanoate (PubChem CID 130374803) has the molecular formula C16H18F2O8 and a molecular weight of 376.31 g/mol. Its IUPAC name is (9-hydroxy-10-oxospiro[3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecane-4,5'-bicyclo[2.2.1]heptane]-2'-yl) 2,2-difluoropropanoate.
| Compound Name | (9-hydroxy-10-oxospiro[3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecane-4,5'-bicyclo[2.2.1]heptane]-2'-yl) 2,2-difluoropropanoate |
|---|---|
| PubChem CID | 130374803 |
| Molecular Formula | C16H18F2O8 |
| Molecular Weight | 376.31 g/mol |
| Exact Mass | 376.10 |
| IUPAC Name | (9-hydroxy-10-oxospiro[3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecane-4,5'-bicyclo[2.2.1]heptane]-2'-yl) 2,2-difluoropropanoate |
| SMILES | CC(F)(F)C(=O)OC1CC2CC1CC21OC2OC3C(O)C(=O)OC3C2O1 |
| InChI | InChI=1S/C16H18F2O8/c1-15(17,18)14(21)22-7-3-6-2-5(7)4-16(6)25-11-10-9(24-13(11)26-16)8(19)12(20)23-10/h5-11,13,19H,2-4H2,1H3 |
| InChIKey | YSUVWGGZHPCZOD-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.31 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |