C10H16ClN5O2S — CID 13037972
(2S)-2-(2-chloroethylcarbamoylamino)-3-methyl-N-(1,3,4-thiadiazol-2-yl)butanamide (PubChem CID 13037972) has the molecular formula C10H16ClN5O2S and a molecular weight of 305.79 g/mol. Its IUPAC name is (2S)-2-(2-chloroethylcarbamoylamino)-3-methyl-N-(1,3,4-thiadiazol-2-yl)butanamide.
| Compound Name | (2S)-2-(2-chloroethylcarbamoylamino)-3-methyl-N-(1,3,4-thiadiazol-2-yl)butanamide |
|---|---|
| PubChem CID | 13037972 |
| Molecular Formula | C10H16ClN5O2S |
| Molecular Weight | 305.79 g/mol |
| Exact Mass | 305.07 |
| IUPAC Name | (2S)-2-(2-chloroethylcarbamoylamino)-3-methyl-N-(1,3,4-thiadiazol-2-yl)butanamide |
| SMILES | CC(C)[C@H](NC(=O)NCCCl)C(=O)Nc1nncs1 |
| InChI | InChI=1S/C10H16ClN5O2S/c1-6(2)7(14-9(18)12-4-3-11)8(17)15-10-16-13-5-19-10/h5-7H,3-4H2,1-2H3,(H2,12,14,18)(H,15,16,17)/t7-/m0/s1 |
| InChIKey | NRHBDSNTJBSOGY-ZETCQYMHSA-N |
| XLogP | 1.04 |
| TPSA | 96.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.79 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|