About N-hydroxy-N'-(2-hydroxyethyl)ethanimidamide
N-hydroxy-N'-(2-hydroxyethyl)ethanimidamide (PubChem CID 130383986) has the molecular formula C4H10N2O2
and a molecular weight of 118.14 g/mol. Its IUPAC name is N-hydroxy-N'-(2-hydroxyethyl)ethanimidamide.
Molecular Properties
| Compound Name | N-hydroxy-N'-(2-hydroxyethyl)ethanimidamide |
| PubChem CID | 130383986 |
| Molecular Formula | C4H10N2O2 |
| Molecular Weight | 118.14 g/mol |
| Exact Mass | 118.07 |
| IUPAC Name | N-hydroxy-N'-(2-hydroxyethyl)ethanimidamide |
| SMILES | C/C(=N\CCO)NO |
| InChI | InChI=1S/C4H10N2O2/c1-4(6-8)5-2-3-7/h7-8H,2-3H2,1H3,(H,5,6) |
| InChIKey | DLOLZBCKBUGWOM-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 64.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 118.14 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-hydroxy-N'-(2-hydroxyethyl)ethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-hydroxy-N'-(2-hydroxyethyl)ethanimidamide?
The IUPAC name of N-hydroxy-N'-(2-hydroxyethyl)ethanimidamide (CID 130383986) is N-hydroxy-N'-(2-hydroxyethyl)ethanimidamide.
What is the SMILES notation for N-hydroxy-N'-(2-hydroxyethyl)ethanimidamide?
The canonical SMILES for N-hydroxy-N'-(2-hydroxyethyl)ethanimidamide is C/C(=N\CCO)NO.
What is the InChIKey of N-hydroxy-N'-(2-hydroxyethyl)ethanimidamide?
The InChIKey is DLOLZBCKBUGWOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10N2O2/c1-4(6-8)5-2-3-7/h7-8H,2-3H2,1H3,(H,5,6).
What are the key properties of N-hydroxy-N'-(2-hydroxyethyl)ethanimidamide?
N-hydroxy-N'-(2-hydroxyethyl)ethanimidamide has a molecular weight of 118.14 g/mol, XLogP of -0.62, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-hydroxy-N'-(2-hydroxyethyl)ethanimidamide is sourced from PubChem (CID 130383986), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).