C14H28N2O4 — CID 130387395
[2-methyl-6-[2-methyl-1-(methylamino)-1-oxopropan-2-yl]oxyhexan-2-yl] N-methylcarbamate (PubChem CID 130387395) has the molecular formula C14H28N2O4 and a molecular weight of 288.39 g/mol. Its IUPAC name is [2-methyl-6-[2-methyl-1-(methylamino)-1-oxopropan-2-yl]oxyhexan-2-yl] N-methylcarbamate.
| Compound Name | [2-methyl-6-[2-methyl-1-(methylamino)-1-oxopropan-2-yl]oxyhexan-2-yl] N-methylcarbamate |
|---|---|
| PubChem CID | 130387395 |
| Molecular Formula | C14H28N2O4 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.20 |
| IUPAC Name | [2-methyl-6-[2-methyl-1-(methylamino)-1-oxopropan-2-yl]oxyhexan-2-yl] N-methylcarbamate |
| SMILES | CNC(=O)OC(C)(C)CCCCOC(C)(C)C(=O)NC |
| InChI | InChI=1S/C14H28N2O4/c1-13(2,20-12(18)16-6)9-7-8-10-19-14(3,4)11(17)15-5/h7-10H2,1-6H3,(H,15,17)(H,16,18) |
| InChIKey | IHBRCPWONSKZGZ-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|