C13H27O5P — CID 130398403
tert-butyl-[2-(4,4-dimethyl-3-oxopentoxy)ethoxy]phosphinic acid (PubChem CID 130398403) has the molecular formula C13H27O5P and a molecular weight of 294.33 g/mol. Its IUPAC name is tert-butyl-[2-(4,4-dimethyl-3-oxopentoxy)ethoxy]phosphinic acid.
| Compound Name | tert-butyl-[2-(4,4-dimethyl-3-oxopentoxy)ethoxy]phosphinic acid |
|---|---|
| PubChem CID | 130398403 |
| Molecular Formula | C13H27O5P |
| Molecular Weight | 294.33 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | tert-butyl-[2-(4,4-dimethyl-3-oxopentoxy)ethoxy]phosphinic acid |
| SMILES | CC(C)(C)C(=O)CCOCCOP(=O)(O)C(C)(C)C |
| InChI | InChI=1S/C13H27O5P/c1-12(2,3)11(14)7-8-17-9-10-18-19(15,16)13(4,5)6/h7-10H2,1-6H3,(H,15,16) |
| InChIKey | YKHKSDIKDQNYSQ-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.33 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|