C24H37N4O7+ — CID 130407067
tert-butyl 3-[[5-[(2S)-2-aminooxy-3-[(2-methylpropan-2-yl)oxy]-3-oxopropoxy]-1-methylindazol-2-ium-2-yl]methyl]-3-hydroxyazetidine-1-carboxylate (PubChem CID 130407067) has the molecular formula C24H37N4O7+ and a molecular weight of 493.58 g/mol. Its IUPAC name is tert-butyl 3-[[5-[(2S)-2-aminooxy-3-[(2-methylpropan-2-yl)oxy]-3-oxopropoxy]-1-methylindazol-2-ium-2-yl]methyl]-3-hydroxyazetidine-1-carboxylate.
| Compound Name | tert-butyl 3-[[5-[(2S)-2-aminooxy-3-[(2-methylpropan-2-yl)oxy]-3-oxopropoxy]-1-methylindazol-2-ium-2-yl]methyl]-3-hydroxyazetidine-1-carboxylate |
|---|---|
| PubChem CID | 130407067 |
| Molecular Formula | C24H37N4O7+ |
| Molecular Weight | 493.58 g/mol |
| Exact Mass | 493.27 |
| IUPAC Name | tert-butyl 3-[[5-[(2S)-2-aminooxy-3-[(2-methylpropan-2-yl)oxy]-3-oxopropoxy]-1-methylindazol-2-ium-2-yl]methyl]-3-hydroxyazetidine-1-carboxylate |
| SMILES | Cn1c2ccc(OC[C@H](ON)C(=O)OC(C)(C)C)cc2c[n+]1CC1(O)CN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C24H37N4O7/c1-22(2,3)33-20(29)19(35-25)12-32-17-8-9-18-16(10-17)11-28(26(18)7)15-24(31)13-27(14-24)21(30)34-23(4,5)6/h8-11,19,31H,12-15,25H2,1-7H3/q+1/t19-/m0/s1 |
| InChIKey | PBVDDYZTDJYIOD-IBGZPJMESA-N |
| XLogP | 1.43 |
| TPSA | 129.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.58 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|