C19H19F2N3O4 — CID 130408535
4-[2-(cyclopentyloxyamino)-2-oxoacetyl]-N-(3,4-difluorophenyl)-1-methylpyrrole-2-carboxamide (PubChem CID 130408535) has the molecular formula C19H19F2N3O4 and a molecular weight of 391.37 g/mol. Its IUPAC name is 4-[2-(cyclopentyloxyamino)-2-oxoacetyl]-N-(3,4-difluorophenyl)-1-methylpyrrole-2-carboxamide.
| Compound Name | 4-[2-(cyclopentyloxyamino)-2-oxoacetyl]-N-(3,4-difluorophenyl)-1-methylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 130408535 |
| Molecular Formula | C19H19F2N3O4 |
| Molecular Weight | 391.37 g/mol |
| Exact Mass | 391.13 |
| IUPAC Name | 4-[2-(cyclopentyloxyamino)-2-oxoacetyl]-N-(3,4-difluorophenyl)-1-methylpyrrole-2-carboxamide |
| SMILES | Cn1cc(C(=O)C(=O)NOC2CCCC2)cc1C(=O)Nc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C19H19F2N3O4/c1-24-10-11(17(25)19(27)23-28-13-4-2-3-5-13)8-16(24)18(26)22-12-6-7-14(20)15(21)9-12/h6-10,13H,2-5H2,1H3,(H,22,26)(H,23,27) |
| InChIKey | KKBKONRQCDNYTB-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 89.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.37 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|