C22H20N2O3S2 — CID 130412247
N-[2-[[3-(methoxyamino)phenyl]methylsulfanyl]phenyl]-1-benzofuran-2-sulfinamide (PubChem CID 130412247) has the molecular formula C22H20N2O3S2 and a molecular weight of 424.55 g/mol. Its IUPAC name is N-[2-[[3-(methoxyamino)phenyl]methylsulfanyl]phenyl]-1-benzofuran-2-sulfinamide.
| Compound Name | N-[2-[[3-(methoxyamino)phenyl]methylsulfanyl]phenyl]-1-benzofuran-2-sulfinamide |
|---|---|
| PubChem CID | 130412247 |
| Molecular Formula | C22H20N2O3S2 |
| Molecular Weight | 424.55 g/mol |
| Exact Mass | 424.09 |
| IUPAC Name | N-[2-[[3-(methoxyamino)phenyl]methylsulfanyl]phenyl]-1-benzofuran-2-sulfinamide |
| SMILES | CONc1cccc(CSc2ccccc2NS(=O)c2cc3ccccc3o2)c1 |
| InChI | InChI=1S/C22H20N2O3S2/c1-26-23-18-9-6-7-16(13-18)15-28-21-12-5-3-10-19(21)24-29(25)22-14-17-8-2-4-11-20(17)27-22/h2-14,23-24H,15H2,1H3 |
| InChIKey | NEUQOQLGOWJQPB-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 63.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.55 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|