About 1-benzofuran-2-sulfinic acid
1-benzofuran-2-sulfinic acid (PubChem CID 19900751) has the molecular formula C8H6O3S
and a molecular weight of 182.20 g/mol. Its IUPAC name is 1-benzofuran-2-sulfinic acid.
Molecular Properties
| Compound Name | 1-benzofuran-2-sulfinic acid |
| PubChem CID | 19900751 |
| Molecular Formula | C8H6O3S |
| Molecular Weight | 182.20 g/mol |
| Exact Mass | 182.00 |
| IUPAC Name | 1-benzofuran-2-sulfinic acid |
| SMILES | O=S(O)c1cc2ccccc2o1 |
| InChI | InChI=1S/C8H6O3S/c9-12(10)8-5-6-3-1-2-4-7(6)11-8/h1-5H,(H,9,10) |
| InChIKey | NEYNTOLNQXXOAT-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 50.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.20 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze 1-benzofuran-2-sulfinic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzofuran-2-sulfinic acid?
The IUPAC name of 1-benzofuran-2-sulfinic acid (CID 19900751) is 1-benzofuran-2-sulfinic acid.
What is the SMILES notation for 1-benzofuran-2-sulfinic acid?
The canonical SMILES for 1-benzofuran-2-sulfinic acid is O=S(O)c1cc2ccccc2o1.
What is the InChIKey of 1-benzofuran-2-sulfinic acid?
The InChIKey is NEYNTOLNQXXOAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6O3S/c9-12(10)8-5-6-3-1-2-4-7(6)11-8/h1-5H,(H,9,10).
What are the key properties of 1-benzofuran-2-sulfinic acid?
1-benzofuran-2-sulfinic acid has a molecular weight of 182.20 g/mol, XLogP of 2.01, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzofuran-2-sulfinic acid is sourced from PubChem (CID 19900751), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).