C21H16ClNO4S2 — CID 130412277
N-(2-benzylsulfonyl-5-chlorophenyl)-1-benzofuran-2-sulfinamide (PubChem CID 130412277) has the molecular formula C21H16ClNO4S2 and a molecular weight of 445.95 g/mol. Its IUPAC name is N-(2-benzylsulfonyl-5-chlorophenyl)-1-benzofuran-2-sulfinamide.
| Compound Name | N-(2-benzylsulfonyl-5-chlorophenyl)-1-benzofuran-2-sulfinamide |
|---|---|
| PubChem CID | 130412277 |
| Molecular Formula | C21H16ClNO4S2 |
| Molecular Weight | 445.95 g/mol |
| Exact Mass | 445.02 |
| IUPAC Name | N-(2-benzylsulfonyl-5-chlorophenyl)-1-benzofuran-2-sulfinamide |
| SMILES | O=S(Nc1cc(Cl)ccc1S(=O)(=O)Cc1ccccc1)c1cc2ccccc2o1 |
| InChI | InChI=1S/C21H16ClNO4S2/c22-17-10-11-20(29(25,26)14-15-6-2-1-3-7-15)18(13-17)23-28(24)21-12-16-8-4-5-9-19(16)27-21/h1-13,23H,14H2 |
| InChIKey | PKOVLYPWBHHCQK-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.95 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |