C21H19ClN2O4S2 — CID 138625456
N-[5-chloro-2-[(2Z,4Z)-2-(methylideneamino)hexa-2,4-dienyl]sulfinylphenyl]-1-benzofuran-2-sulfonamide (PubChem CID 138625456) has the molecular formula C21H19ClN2O4S2 and a molecular weight of 462.98 g/mol. Its IUPAC name is N-[5-chloro-2-[(2Z,4Z)-2-(methylideneamino)hexa-2,4-dienyl]sulfinylphenyl]-1-benzofuran-2-sulfonamide.
| Compound Name | N-[5-chloro-2-[(2Z,4Z)-2-(methylideneamino)hexa-2,4-dienyl]sulfinylphenyl]-1-benzofuran-2-sulfonamide |
|---|---|
| PubChem CID | 138625456 |
| Molecular Formula | C21H19ClN2O4S2 |
| Molecular Weight | 462.98 g/mol |
| Exact Mass | 462.05 |
| IUPAC Name | N-[5-chloro-2-[(2Z,4Z)-2-(methylideneamino)hexa-2,4-dienyl]sulfinylphenyl]-1-benzofuran-2-sulfonamide |
| SMILES | C=N/C(=C\C=C/C)CS(=O)c1ccc(Cl)cc1NS(=O)(=O)c1cc2ccccc2o1 |
| InChI | InChI=1S/C21H19ClN2O4S2/c1-3-4-8-17(23-2)14-29(25)20-11-10-16(22)13-18(20)24-30(26,27)21-12-15-7-5-6-9-19(15)28-21/h3-13,24H,2,14H2,1H3/b4-3-,17-8- |
| InChIKey | VZNDHFFWZWTVEE-LFSDHGSESA-N |
| XLogP | 5.16 |
| TPSA | 88.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.98 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|