C29H27FO3P+ — CID 130412943
[3-(2-fluoroethoxy)phenyl]-[(4-methoxycarbonylphenyl)methyl]-diphenylphosphanium (PubChem CID 130412943) has the molecular formula C29H27FO3P+ and a molecular weight of 473.50 g/mol. Its IUPAC name is [3-(2-fluoroethoxy)phenyl]-[(4-methoxycarbonylphenyl)methyl]-diphenylphosphanium.
| Compound Name | [3-(2-fluoroethoxy)phenyl]-[(4-methoxycarbonylphenyl)methyl]-diphenylphosphanium |
|---|---|
| PubChem CID | 130412943 |
| Molecular Formula | C29H27FO3P+ |
| Molecular Weight | 473.50 g/mol |
| Exact Mass | 473.17 |
| IUPAC Name | [3-(2-fluoroethoxy)phenyl]-[(4-methoxycarbonylphenyl)methyl]-diphenylphosphanium |
| SMILES | COC(=O)c1ccc(C[P+](c2ccccc2)(c2ccccc2)c2cccc(OCCF)c2)cc1 |
| InChI | InChI=1S/C29H27FO3P/c1-32-29(31)24-17-15-23(16-18-24)22-34(26-10-4-2-5-11-26,27-12-6-3-7-13-27)28-14-8-9-25(21-28)33-20-19-30/h2-18,21H,19-20,22H2,1H3/q+1 |
| InChIKey | DJGSOFNLHRMJEH-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.50 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|