C28H25NO4P+ — CID 56935297
[2,6-bis(methoxycarbonyl)-4-pyridinyl]methyl-triphenylphosphanium (PubChem CID 56935297) has the molecular formula C28H25NO4P+ and a molecular weight of 470.49 g/mol. Its IUPAC name is [2,6-bis(methoxycarbonyl)-4-pyridinyl]methyl-triphenylphosphanium.
| Compound Name | [2,6-bis(methoxycarbonyl)-4-pyridinyl]methyl-triphenylphosphanium |
|---|---|
| PubChem CID | 56935297 |
| Molecular Formula | C28H25NO4P+ |
| Molecular Weight | 470.49 g/mol |
| Exact Mass | 470.15 |
| IUPAC Name | [2,6-bis(methoxycarbonyl)-4-pyridinyl]methyl-triphenylphosphanium |
| SMILES | COC(=O)c1cc(C[P+](c2ccccc2)(c2ccccc2)c2ccccc2)cc(C(=O)OC)n1 |
| InChI | InChI=1S/C28H25NO4P/c1-32-27(30)25-18-21(19-26(29-25)28(31)33-2)20-34(22-12-6-3-7-13-22,23-14-8-4-9-15-23)24-16-10-5-11-17-24/h3-19H,20H2,1-2H3/q+1 |
| InChIKey | IQRDYDNUYMAAMB-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.49 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|