C14H19F11N2O — CID 130418348
(2R)-4-[2-[azepan-1-yl(fluoro)methyl]-2,3,3,3-tetrafluoropropoxy]-1,1,1,2,3,3-hexafluorobutan-2-amine (PubChem CID 130418348) has the molecular formula C14H19F11N2O and a molecular weight of 440.30 g/mol. Its IUPAC name is (2R)-4-[2-[azepan-1-yl(fluoro)methyl]-2,3,3,3-tetrafluoropropoxy]-1,1,1,2,3,3-hexafluorobutan-2-amine.
| Compound Name | (2R)-4-[2-[azepan-1-yl(fluoro)methyl]-2,3,3,3-tetrafluoropropoxy]-1,1,1,2,3,3-hexafluorobutan-2-amine |
|---|---|
| PubChem CID | 130418348 |
| Molecular Formula | C14H19F11N2O |
| Molecular Weight | 440.30 g/mol |
| Exact Mass | 440.13 |
| IUPAC Name | (2R)-4-[2-[azepan-1-yl(fluoro)methyl]-2,3,3,3-tetrafluoropropoxy]-1,1,1,2,3,3-hexafluorobutan-2-amine |
| SMILES | N[C@](F)(C(F)(F)F)C(F)(F)COCC(F)(C(F)N1CCCCCC1)C(F)(F)F |
| InChI | InChI=1S/C14H19F11N2O/c15-9(27-5-3-1-2-4-6-27)10(16,13(20,21)22)7-28-8-11(17,18)12(19,26)14(23,24)25/h9H,1-8,26H2/t9?,10?,12-/m0/s1 |
| InChIKey | RYLBEQGDUOYYLF-CBINBANVSA-N |
| XLogP | 4.27 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.30 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|