C10H9F10N — CID 130418362
1-[(Z)-1,3,3,3-tetrafluoroprop-1-enyl]-3,5-bis(trifluoromethyl)piperidine (PubChem CID 130418362) has the molecular formula C10H9F10N and a molecular weight of 333.17 g/mol. Its IUPAC name is 1-[(Z)-1,3,3,3-tetrafluoroprop-1-enyl]-3,5-bis(trifluoromethyl)piperidine.
| Compound Name | 1-[(Z)-1,3,3,3-tetrafluoroprop-1-enyl]-3,5-bis(trifluoromethyl)piperidine |
|---|---|
| PubChem CID | 130418362 |
| Molecular Formula | C10H9F10N |
| Molecular Weight | 333.17 g/mol |
| Exact Mass | 333.06 |
| IUPAC Name | 1-[(Z)-1,3,3,3-tetrafluoroprop-1-enyl]-3,5-bis(trifluoromethyl)piperidine |
| SMILES | F/C(=C\C(F)(F)F)N1CC(C(F)(F)F)CC(C(F)(F)F)C1 |
| InChI | InChI=1S/C10H9F10N/c11-7(2-8(12,13)14)21-3-5(9(15,16)17)1-6(4-21)10(18,19)20/h2,5-6H,1,3-4H2/b7-2+ |
| InChIKey | QIELDMQVWKCMQV-FARCUNLSSA-N |
| XLogP | 4.42 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.17 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|