C12H17F9N2O — CID 130418459
1-methyl-4-[1,2,2-trifluoro-3-(2,2,3,4,4,4-hexafluorobutoxy)propyl]piperazine (PubChem CID 130418459) has the molecular formula C12H17F9N2O and a molecular weight of 376.26 g/mol. Its IUPAC name is 1-methyl-4-[1,2,2-trifluoro-3-(2,2,3,4,4,4-hexafluorobutoxy)propyl]piperazine.
| Compound Name | 1-methyl-4-[1,2,2-trifluoro-3-(2,2,3,4,4,4-hexafluorobutoxy)propyl]piperazine |
|---|---|
| PubChem CID | 130418459 |
| Molecular Formula | C12H17F9N2O |
| Molecular Weight | 376.26 g/mol |
| Exact Mass | 376.12 |
| IUPAC Name | 1-methyl-4-[1,2,2-trifluoro-3-(2,2,3,4,4,4-hexafluorobutoxy)propyl]piperazine |
| SMILES | CN1CCN(C(F)C(F)(F)COCC(F)(F)C(F)C(F)(F)F)CC1 |
| InChI | InChI=1S/C12H17F9N2O/c1-22-2-4-23(5-3-22)9(14)11(17,18)7-24-6-10(15,16)8(13)12(19,20)21/h8-9H,2-7H2,1H3 |
| InChIKey | WXGRJFMKVQZSLZ-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.26 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|