C20H21N7O3 — CID 130424483
1-(5-tert-butyl-1,2-oxazol-3-yl)-3-[4-(6-methoxypurin-7-yl)phenyl]urea (PubChem CID 130424483) has the molecular formula C20H21N7O3 and a molecular weight of 407.43 g/mol. Its IUPAC name is 1-(5-tert-butyl-1,2-oxazol-3-yl)-3-[4-(6-methoxypurin-7-yl)phenyl]urea.
| Compound Name | 1-(5-tert-butyl-1,2-oxazol-3-yl)-3-[4-(6-methoxypurin-7-yl)phenyl]urea |
|---|---|
| PubChem CID | 130424483 |
| Molecular Formula | C20H21N7O3 |
| Molecular Weight | 407.43 g/mol |
| Exact Mass | 407.17 |
| IUPAC Name | 1-(5-tert-butyl-1,2-oxazol-3-yl)-3-[4-(6-methoxypurin-7-yl)phenyl]urea |
| SMILES | COc1ncnc2ncn(-c3ccc(NC(=O)Nc4cc(C(C)(C)C)on4)cc3)c12 |
| InChI | InChI=1S/C20H21N7O3/c1-20(2,3)14-9-15(26-30-14)25-19(28)24-12-5-7-13(8-6-12)27-11-23-17-16(27)18(29-4)22-10-21-17/h5-11H,1-4H3,(H2,24,25,26,28) |
| InChIKey | AGSVSBDQZCMLKZ-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 119.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.43 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |