C17H27N4PS — CID 130445073
1-[2-[(3aR,7aR)-1,3-dimethyl-3a,4,5,6,7,7a-hexahydrobenzo[d][1,3,2]diazaphosphol-2-yl]ethyl]-3-phenylthiourea (PubChem CID 130445073) has the molecular formula C17H27N4PS and a molecular weight of 350.47 g/mol. Its IUPAC name is 1-[2-[(3aR,7aR)-1,3-dimethyl-3a,4,5,6,7,7a-hexahydrobenzo[d][1,3,2]diazaphosphol-2-yl]ethyl]-3-phenylthiourea.
| Compound Name | 1-[2-[(3aR,7aR)-1,3-dimethyl-3a,4,5,6,7,7a-hexahydrobenzo[d][1,3,2]diazaphosphol-2-yl]ethyl]-3-phenylthiourea |
|---|---|
| PubChem CID | 130445073 |
| Molecular Formula | C17H27N4PS |
| Molecular Weight | 350.47 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | 1-[2-[(3aR,7aR)-1,3-dimethyl-3a,4,5,6,7,7a-hexahydrobenzo[d][1,3,2]diazaphosphol-2-yl]ethyl]-3-phenylthiourea |
| SMILES | CN1[C@@H]2CCCC[C@H]2N(C)P1CCNC(=S)Nc1ccccc1 |
| InChI | InChI=1S/C17H27N4PS/c1-20-15-10-6-7-11-16(15)21(2)22(20)13-12-18-17(23)19-14-8-4-3-5-9-14/h3-5,8-9,15-16H,6-7,10-13H2,1-2H3,(H2,18,19,23)/t15-,16-/m1/s1 |
| InChIKey | IPULPMHYWOCVSE-HZPDHXFCSA-N |
| XLogP | 3.47 |
| TPSA | 30.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.47 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|