C14H23N4OPS — CID 166839849
1-[2-[(1-ethyl-3-methyl-1,3,2-diazaphospholidin-2-yl)oxy]ethyl]-3-phenylthiourea (PubChem CID 166839849) has the molecular formula C14H23N4OPS and a molecular weight of 326.41 g/mol. Its IUPAC name is 1-[2-[(1-ethyl-3-methyl-1,3,2-diazaphospholidin-2-yl)oxy]ethyl]-3-phenylthiourea.
| Compound Name | 1-[2-[(1-ethyl-3-methyl-1,3,2-diazaphospholidin-2-yl)oxy]ethyl]-3-phenylthiourea |
|---|---|
| PubChem CID | 166839849 |
| Molecular Formula | C14H23N4OPS |
| Molecular Weight | 326.41 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | 1-[2-[(1-ethyl-3-methyl-1,3,2-diazaphospholidin-2-yl)oxy]ethyl]-3-phenylthiourea |
| SMILES | CCN1CCN(C)P1OCCNC(=S)Nc1ccccc1 |
| InChI | InChI=1S/C14H23N4OPS/c1-3-18-11-10-17(2)20(18)19-12-9-15-14(21)16-13-7-5-4-6-8-13/h4-8H,3,9-12H2,1-2H3,(H2,15,16,21) |
| InChIKey | IOKSUDYZNWFURF-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 39.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.41 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|