C21H29N4OPS — CID 134471354
1-[2-[[1,3-di(propan-2-yl)-1,3,2-benzodiazaphosphol-2-yl]oxy]ethyl]-3-phenylthiourea (PubChem CID 134471354) has the molecular formula C21H29N4OPS and a molecular weight of 416.53 g/mol. Its IUPAC name is 1-[2-[[1,3-di(propan-2-yl)-1,3,2-benzodiazaphosphol-2-yl]oxy]ethyl]-3-phenylthiourea.
| Compound Name | 1-[2-[[1,3-di(propan-2-yl)-1,3,2-benzodiazaphosphol-2-yl]oxy]ethyl]-3-phenylthiourea |
|---|---|
| PubChem CID | 134471354 |
| Molecular Formula | C21H29N4OPS |
| Molecular Weight | 416.53 g/mol |
| Exact Mass | 416.18 |
| IUPAC Name | 1-[2-[[1,3-di(propan-2-yl)-1,3,2-benzodiazaphosphol-2-yl]oxy]ethyl]-3-phenylthiourea |
| SMILES | CC(C)N1c2ccccc2N(C(C)C)P1OCCNC(=S)Nc1ccccc1 |
| InChI | InChI=1S/C21H29N4OPS/c1-16(2)24-19-12-8-9-13-20(19)25(17(3)4)27(24)26-15-14-22-21(28)23-18-10-6-5-7-11-18/h5-13,16-17H,14-15H2,1-4H3,(H2,22,23,28) |
| InChIKey | KECHSHLYTLRCJY-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 39.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.53 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|