C30H39N4OP — CID 134475570
1-N-[2-[[(4R,5R)-4,5-diphenyl-1,3-di(propan-2-yl)-1,3,2-diazaphospholidin-2-yl]oxy]ethyl]-1-N'-phenylethene-1,1-diamine (PubChem CID 134475570) has the molecular formula C30H39N4OP and a molecular weight of 502.64 g/mol. Its IUPAC name is 1-N-[2-[[(4R,5R)-4,5-diphenyl-1,3-di(propan-2-yl)-1,3,2-diazaphospholidin-2-yl]oxy]ethyl]-1-N'-phenylethene-1,1-diamine.
| Compound Name | 1-N-[2-[[(4R,5R)-4,5-diphenyl-1,3-di(propan-2-yl)-1,3,2-diazaphospholidin-2-yl]oxy]ethyl]-1-N'-phenylethene-1,1-diamine |
|---|---|
| PubChem CID | 134475570 |
| Molecular Formula | C30H39N4OP |
| Molecular Weight | 502.64 g/mol |
| Exact Mass | 502.29 |
| IUPAC Name | 1-N-[2-[[(4R,5R)-4,5-diphenyl-1,3-di(propan-2-yl)-1,3,2-diazaphospholidin-2-yl]oxy]ethyl]-1-N'-phenylethene-1,1-diamine |
| SMILES | C=C(NCCOP1N(C(C)C)[C@H](c2ccccc2)[C@@H](c2ccccc2)N1C(C)C)Nc1ccccc1 |
| InChI | InChI=1S/C30H39N4OP/c1-23(2)33-29(26-15-9-6-10-16-26)30(27-17-11-7-12-18-27)34(24(3)4)36(33)35-22-21-31-25(5)32-28-19-13-8-14-20-28/h6-20,23-24,29-32H,5,21-22H2,1-4H3/t29-,30-/m1/s1 |
| InChIKey | XCNAIFQRBCYNMS-LOYHVIPDSA-N |
| XLogP | 7.32 |
| TPSA | 39.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.64 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|