C23H35N4O2PS — CID 130445086
1-[2-[(5S,9S)-5,9-ditert-butyl-3,11-dioxa-6,8-diaza-7-phosphatricyclo[6.3.0.02,6]undec-1-en-7-yl]ethyl]-3-phenylthiourea (PubChem CID 130445086) has the molecular formula C23H35N4O2PS and a molecular weight of 462.60 g/mol. Its IUPAC name is 1-[2-[(5S,9S)-5,9-ditert-butyl-3,11-dioxa-6,8-diaza-7-phosphatricyclo[6.3.0.02,6]undec-1-en-7-yl]ethyl]-3-phenylthiourea.
| Compound Name | 1-[2-[(5S,9S)-5,9-ditert-butyl-3,11-dioxa-6,8-diaza-7-phosphatricyclo[6.3.0.02,6]undec-1-en-7-yl]ethyl]-3-phenylthiourea |
|---|---|
| PubChem CID | 130445086 |
| Molecular Formula | C23H35N4O2PS |
| Molecular Weight | 462.60 g/mol |
| Exact Mass | 462.22 |
| IUPAC Name | 1-[2-[(5S,9S)-5,9-ditert-butyl-3,11-dioxa-6,8-diaza-7-phosphatricyclo[6.3.0.02,6]undec-1-en-7-yl]ethyl]-3-phenylthiourea |
| SMILES | CC(C)(C)[C@H]1COC2=C3OC[C@H](C(C)(C)C)N3P(CCNC(=S)Nc3ccccc3)N21 |
| InChI | InChI=1S/C23H35N4O2PS/c1-22(2,3)17-14-28-19-20-27(18(15-29-20)23(4,5)6)30(26(17)19)13-12-24-21(31)25-16-10-8-7-9-11-16/h7-11,17-18H,12-15H2,1-6H3,(H2,24,25,31)/t17-,18-/m1/s1 |
| InChIKey | BAJRDFLCUVQRCW-QZTJIDSGSA-N |
| XLogP | 4.92 |
| TPSA | 49.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.60 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|