C7H11F3OS — CID 130457072
1,1,1-trifluoro-2,2-dimethyl-4-sulfanylpentan-3-one (PubChem CID 130457072) has the molecular formula C7H11F3OS and a molecular weight of 200.22 g/mol. Its IUPAC name is 1,1,1-trifluoro-2,2-dimethyl-4-sulfanylpentan-3-one.
| Compound Name | 1,1,1-trifluoro-2,2-dimethyl-4-sulfanylpentan-3-one |
|---|---|
| PubChem CID | 130457072 |
| Molecular Formula | C7H11F3OS |
| Molecular Weight | 200.22 g/mol |
| Exact Mass | 200.05 |
| IUPAC Name | 1,1,1-trifluoro-2,2-dimethyl-4-sulfanylpentan-3-one |
| SMILES | CC(S)C(=O)C(C)(C)C(F)(F)F |
| InChI | InChI=1S/C7H11F3OS/c1-4(12)5(11)6(2,3)7(8,9)10/h4,12H,1-3H3 |
| InChIKey | FJNZTXLJBJPBTP-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 17.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.22 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|