C26H38O5 — CID 130457880
(3E,9S,11S)-11-hydroxy-7-[(Z,4R)-4-(hydroxymethyl)hex-2-en-2-yl]-9-methoxy-12,12-dimethyl-6-oxabicyclo[11.3.1]heptadeca-1(17),3,13,15-tetraen-5-one (PubChem CID 130457880) has the molecular formula C26H38O5 and a molecular weight of 430.59 g/mol. Its IUPAC name is (3E,9S,11S)-11-hydroxy-7-[(Z,4R)-4-(hydroxymethyl)hex-2-en-2-yl]-9-methoxy-12,12-dimethyl-6-oxabicyclo[11.3.1]heptadeca-1(17),3,13,15-tetraen-5-one.
| Compound Name | (3E,9S,11S)-11-hydroxy-7-[(Z,4R)-4-(hydroxymethyl)hex-2-en-2-yl]-9-methoxy-12,12-dimethyl-6-oxabicyclo[11.3.1]heptadeca-1(17),3,13,15-tetraen-5-one |
|---|---|
| PubChem CID | 130457880 |
| Molecular Formula | C26H38O5 |
| Molecular Weight | 430.59 g/mol |
| Exact Mass | 430.27 |
| IUPAC Name | (3E,9S,11S)-11-hydroxy-7-[(Z,4R)-4-(hydroxymethyl)hex-2-en-2-yl]-9-methoxy-12,12-dimethyl-6-oxabicyclo[11.3.1]heptadeca-1(17),3,13,15-tetraen-5-one |
| SMILES | CC[C@H](/C=C(/C)C1C[C@@H](OC)C[C@H](O)C(C)(C)c2cccc(c2)C/C=C/C(=O)O1)CO |
| InChI | InChI=1S/C26H38O5/c1-6-19(17-27)13-18(2)23-15-22(30-5)16-24(28)26(3,4)21-11-7-9-20(14-21)10-8-12-25(29)31-23/h7-9,11-14,19,22-24,27-28H,6,10,15-17H2,1-5H3/b12-8+,18-13-/t19-,22-,23?,24+/m1/s1 |
| InChIKey | WBJDDAWRFMKSKS-IABPPLCYSA-N |
| XLogP | 4.11 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.59 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|