C24H38O4 — CID 22966993
(3E,13E)-16-[(E)-but-2-en-2-yl]-8-methoxy-5,5,7,9-tetramethyl-1-oxacyclohexadeca-3,13-diene-2,6-dione (PubChem CID 22966993) has the molecular formula C24H38O4 and a molecular weight of 390.56 g/mol. Its IUPAC name is (3E,13E)-16-[(E)-but-2-en-2-yl]-8-methoxy-5,5,7,9-tetramethyl-1-oxacyclohexadeca-3,13-diene-2,6-dione.
| Compound Name | (3E,13E)-16-[(E)-but-2-en-2-yl]-8-methoxy-5,5,7,9-tetramethyl-1-oxacyclohexadeca-3,13-diene-2,6-dione |
|---|---|
| PubChem CID | 22966993 |
| Molecular Formula | C24H38O4 |
| Molecular Weight | 390.56 g/mol |
| Exact Mass | 390.28 |
| IUPAC Name | (3E,13E)-16-[(E)-but-2-en-2-yl]-8-methoxy-5,5,7,9-tetramethyl-1-oxacyclohexadeca-3,13-diene-2,6-dione |
| SMILES | C/C=C(\C)C1C/C=C/CCCC(C)C(OC)C(C)C(=O)C(C)(C)/C=C/C(=O)O1 |
| InChI | InChI=1S/C24H38O4/c1-8-17(2)20-14-12-10-9-11-13-18(3)22(27-7)19(4)23(26)24(5,6)16-15-21(25)28-20/h8,10,12,15-16,18-20,22H,9,11,13-14H2,1-7H3/b12-10+,16-15+,17-8+ |
| InChIKey | XPONFOHJHILDLO-MMQKLIBLSA-N |
| XLogP | 5.43 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.56 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|