C28H43NO4S — CID 142191236
(3E,16S)-13-(methoxymethyl)-5,5,7,9-tetramethyl-16-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-1-oxacyclohexadec-3-ene-2,6-dione (PubChem CID 142191236) has the molecular formula C28H43NO4S and a molecular weight of 489.72 g/mol. Its IUPAC name is (3E,16S)-13-(methoxymethyl)-5,5,7,9-tetramethyl-16-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-1-oxacyclohexadec-3-ene-2,6-dione.
| Compound Name | (3E,16S)-13-(methoxymethyl)-5,5,7,9-tetramethyl-16-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-1-oxacyclohexadec-3-ene-2,6-dione |
|---|---|
| PubChem CID | 142191236 |
| Molecular Formula | C28H43NO4S |
| Molecular Weight | 489.72 g/mol |
| Exact Mass | 489.29 |
| IUPAC Name | (3E,16S)-13-(methoxymethyl)-5,5,7,9-tetramethyl-16-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-1-oxacyclohexadec-3-ene-2,6-dione |
| SMILES | COCC1CCCC(C)CC(C)C(=O)C(C)(C)/C=C/C(=O)O[C@H](/C(C)=C/c2csc(C)n2)CC1 |
| InChI | InChI=1S/C28H43NO4S/c1-19-9-8-10-23(17-32-7)11-12-25(20(2)16-24-18-34-22(4)29-24)33-26(30)13-14-28(5,6)27(31)21(3)15-19/h13-14,16,18-19,21,23,25H,8-12,15,17H2,1-7H3/b14-13+,20-16+/t19?,21?,23?,25-/m0/s1 |
| InChIKey | RUCCPAOCVROVRV-AAHQZLETSA-N |
| XLogP | 6.81 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.72 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |