C25H36O3 — CID 144851300
(3E,7S)-7-[(Z)-4-(hydroxymethyl)hex-2-en-2-yl]-12,12-dimethyl-6-oxabicyclo[11.3.1]heptadeca-1(17),3,13,15-tetraen-5-one (PubChem CID 144851300) has the molecular formula C25H36O3 and a molecular weight of 384.56 g/mol. Its IUPAC name is (3E,7S)-7-[(Z)-4-(hydroxymethyl)hex-2-en-2-yl]-12,12-dimethyl-6-oxabicyclo[11.3.1]heptadeca-1(17),3,13,15-tetraen-5-one.
| Compound Name | (3E,7S)-7-[(Z)-4-(hydroxymethyl)hex-2-en-2-yl]-12,12-dimethyl-6-oxabicyclo[11.3.1]heptadeca-1(17),3,13,15-tetraen-5-one |
|---|---|
| PubChem CID | 144851300 |
| Molecular Formula | C25H36O3 |
| Molecular Weight | 384.56 g/mol |
| Exact Mass | 384.27 |
| IUPAC Name | (3E,7S)-7-[(Z)-4-(hydroxymethyl)hex-2-en-2-yl]-12,12-dimethyl-6-oxabicyclo[11.3.1]heptadeca-1(17),3,13,15-tetraen-5-one |
| SMILES | CCC(/C=C(/C)[C@@H]1CCCCC(C)(C)c2cccc(c2)C/C=C/C(=O)O1)CO |
| InChI | InChI=1S/C25H36O3/c1-5-20(18-26)16-19(2)23-13-6-7-15-25(3,4)22-12-8-10-21(17-22)11-9-14-24(27)28-23/h8-10,12,14,16-17,20,23,26H,5-7,11,13,15,18H2,1-4H3/b14-9+,19-16-/t20?,23-/m0/s1 |
| InChIKey | KXSJAENZIKBAJI-MPHIAFHJSA-N |
| XLogP | 5.51 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.56 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|