C4H12N2O — CID 130458479
(1R)-1-methoxy-N',N'-dimethylmethanediamine (PubChem CID 130458479) has the molecular formula C4H12N2O and a molecular weight of 104.15 g/mol. Its IUPAC name is (1R)-1-methoxy-N',N'-dimethylmethanediamine.
| Compound Name | (1R)-1-methoxy-N',N'-dimethylmethanediamine |
|---|---|
| PubChem CID | 130458479 |
| Molecular Formula | C4H12N2O |
| Molecular Weight | 104.15 g/mol |
| Exact Mass | 104.09 |
| IUPAC Name | (1R)-1-methoxy-N',N'-dimethylmethanediamine |
| SMILES | CO[C@H](N)N(C)C |
| InChI | InChI=1S/C4H12N2O/c1-6(2)4(5)7-3/h4H,5H2,1-3H3/t4-/m1/s1 |
| InChIKey | XYMRNXRUGDWSAA-SCSAIBSYSA-N |
| XLogP | -0.56 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 104.15 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|