C24H27ClN6O — CID 130471154
1-(1-chloro-3-methylisoquinolin-4-yl)-3-[4-[5-(3-methylbutyl)-1,2-dihydrotriazol-3-yl]phenyl]urea (PubChem CID 130471154) has the molecular formula C24H27ClN6O and a molecular weight of 450.97 g/mol. Its IUPAC name is 1-(1-chloro-3-methylisoquinolin-4-yl)-3-[4-[5-(3-methylbutyl)-1,2-dihydrotriazol-3-yl]phenyl]urea.
| Compound Name | 1-(1-chloro-3-methylisoquinolin-4-yl)-3-[4-[5-(3-methylbutyl)-1,2-dihydrotriazol-3-yl]phenyl]urea |
|---|---|
| PubChem CID | 130471154 |
| Molecular Formula | C24H27ClN6O |
| Molecular Weight | 450.97 g/mol |
| Exact Mass | 450.19 |
| IUPAC Name | 1-(1-chloro-3-methylisoquinolin-4-yl)-3-[4-[5-(3-methylbutyl)-1,2-dihydrotriazol-3-yl]phenyl]urea |
| SMILES | Cc1nc(Cl)c2ccccc2c1NC(=O)Nc1ccc(N2C=C(CCC(C)C)NN2)cc1 |
| InChI | InChI=1S/C24H27ClN6O/c1-15(2)8-9-18-14-31(30-29-18)19-12-10-17(11-13-19)27-24(32)28-22-16(3)26-23(25)21-7-5-4-6-20(21)22/h4-7,10-15,29-30H,8-9H2,1-3H3,(H2,27,28,32) |
| InChIKey | PUWPMBYLNMKXCJ-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 81.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.97 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|