C18H36O9P2 — CID 130472586
(6-diethoxyphosphoryl-6-diethoxyphosphoryloxyhexyl) 2-methylprop-2-enoate (PubChem CID 130472586) has the molecular formula C18H36O9P2 and a molecular weight of 458.43 g/mol. Its IUPAC name is (6-diethoxyphosphoryl-6-diethoxyphosphoryloxyhexyl) 2-methylprop-2-enoate.
| Compound Name | (6-diethoxyphosphoryl-6-diethoxyphosphoryloxyhexyl) 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 130472586 |
| Molecular Formula | C18H36O9P2 |
| Molecular Weight | 458.43 g/mol |
| Exact Mass | 458.18 |
| IUPAC Name | (6-diethoxyphosphoryl-6-diethoxyphosphoryloxyhexyl) 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCCCC(OP(=O)(OCC)OCC)P(=O)(OCC)OCC |
| InChI | InChI=1S/C18H36O9P2/c1-7-23-28(20,24-8-2)17(27-29(21,25-9-3)26-10-4)14-12-11-13-15-22-18(19)16(5)6/h17H,5,7-15H2,1-4,6H3 |
| InChIKey | QFNUHVFQSNCTQF-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.43 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|